Visit our website to find more information like suppliers, MSDS, infra-red (IR), nuclear magnetic resonance spectra (NMR), bp, mp, nd20, molecular formula (MF), molfile, sdf file, structure, 3d model. You will also find information like safety, risk, hazard and MSDS.
This database is a catalog of over 1500000 chemicals and over 1000 chemical suppliers. If you are a supplier you may also add your own catalog of chemicals for free.
|
Click on a product name to get more information on that compound, on a supplier name to get more information on that supplier.
|
|
Supplier
|
Description
|
Reference
|
| abcr
|
Bis(4-nitrophenyl)phosphoric acid; 98%
|
|
| alkemi
|
Bis(4-nitrophenyl)phosphate hydrate, 98%
|
|
| tcieurope
|
| Bis(4-nitrophenyl)phosphoric Acid [for Phosphodiesterase Substrate] |
| , 98.0%
|
|
|
B1098-0001 |
1G |
|
B1098-0010 |
10G |
|
| dehayer
|
| Bis(4-nitrophenyl)hydrogen phosphate |
| |
|
|
| commingchem
|
| Bis(4-nitrophenyl) phosphate |
| |
|
|
| leputech
|
| Bis(4-nitrophenyl)hydrogen phosphate |
| |
|
|
| chemhere
|
| Bis(4-nitrophenyl) phosphate |
| , 99%
|
|
|
| zrunchem
|
| Bis(4-nitrophenyl)phosphate |
| |
|
|
| gs-chem
|
| Bis(4-nitrophenyl)phosphate |
| , 98,0%
|
|
|
| matrixswitzerland
|
| Bis(4-nitrophenyl)hydrogen phosphate |
| |
|
|
| conier
|
| Bis(4-nitrophenyl) phosphate |
| , 99%
|
|
|
| kinbester
|
| Bis(4-Nitrophenyl)Hydrogen Phosphate |
| |
|
|
| ringchemicals
|
| Bis(4-nitrophenyl)phosphate |
| , >99%
|
|
|
| fwdchem
|
| Bis(4-nitrophenyl)phosphate |
| , 98.00%
|
|
|
| dayangchem
|
| Bis(4-nitrophenyl) hydrogen phosphate |
| |
|
|
| labseeker
|
| Bis(4-nitrophenyl)phosphate |
| , 98.00%
|
|
|
| chemner
|
| Bis(4-nitrophenyl) phosphate |
| , 99%
|
|
|
| pipharm
|
| Bis(4-nitrophenyl)phosphate |
| , 98,0%
|
|
|
| frappspharma
|
| Bis(4-nitrophenyl)phosphoric acid |
| |
|
|
| chemos
|
Bis(4-Nitrophenyl)phosphate
|
|
List all chemical suppliers for this product and get quotes
ChemExper Chemical Directory : catalog of chemicals and suppliers